97845-60-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C11H12O4S.
The synonyms of the compound are:
97852-94-3
2-Propenoic acid, 3-(3,4-dimethoxyphenyl)-2-mercapto-
3-(3,4-Dimethoxyphenyl)-2-mercaptoacrylic acid
SCHEMBL9130918
(Z)-3-(3,4-dimethoxyphenyl)-2-sulfanylprop-2-enoic acid
The molecular weight of the compound is 240.28 g/mol.
The IUPAC name of the compound is (Z)-3-(3,4-dimethoxyphenyl)-2-sulfanylprop-2-enoic acid.
The InChIKey of the compound is CBSSDYIFWLVFGD-POHAHGRESA-N.
The canonical SMILES of the compound is COC1=C(C=C(C=C1)C=C(C(=O)O)S)OC.
The CAS number of the compound is 97852-94-3.
The XLogP3 value of the compound is 1.8.
The compound has 2 hydrogen bond donor counts.
The compound has 4 rotatable bond counts.