97820-93-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C18H24ClNO3.
The molecular weight of the compound is 337.8 g/mol.
The IUPAC name of the compound is 4-[(3R)-3-[[(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol hydrochloride.
The InChI of the compound is InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-8-16(20)9-5-14)19-12-18(22)15-6-10-17(21)11-7-15;/h4-11,13,18-22H,2-3,12H2,1H3;1H/t13-,18+;/m1./s1.
The InChIKey of the compound is JHGSLSLUFMZUMK-WJKBNZMCSA-N.
The canonical SMILES of the compound is CC(CCC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O.Cl.
The isomeric SMILES of the compound is C[C@H](CCC1=CC=C(C=C1)O)NC[C@@H](C2=CC=C(C=C2)O)O.Cl.
The CAS number of the compound is 74432-68-1.
The UNII of the compound is 8XI60IX48K.
The hydrogen bond donor count of the compound is 5.