97281-59-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-(3-methylphenyl)ethylhydrazine hydrochloride.
The molecular formula of the compound is C9H15ClN2.
The molecular weight of the compound is 186.68 g/mol.
The InChI of the compound is InChI=1S/C9H14N2.ClH/c1-8-3-2-4-9(7-8)5-6-11-10;/h2-4,7,11H,5-6,10H2,1H3;1H.
The InChIKey of the compound is DBXLKELWROUMOO-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is CC1=CC(=CC=C1)CCNN.Cl.
The compound has 3 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
The topological polar surface area of the compound is 38.2.