97158-14-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is calcium;hexabromosilicon(2-).
The InChI of the compound is InChI=1S/Br6Si.Ca/c1-7(2,3,4,5)6;/q-2;+2.
The InChIKey of the compound is NXECMOZIKJGHJS-UHFFFAOYSA-N.
The canonical SMILES of the compound is [Si-2](Br)(Br)(Br)(Br)(Br)Br.[Ca+2].
The molecular weight of the compound is 547.6 g/mol.
There are 0 hydrogen bond donor counts in the compound.
There is 1 hydrogen bond acceptor count in the compound.
The exact mass of the compound is 547.44339 g/mol.
There are 8 heavy atoms in the compound.
Yes, the compound is canonicalized.