97089-72-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Amino-3,5-dibromobenzene-1-carbohydrazide is C7H7Br2N3O.
The molecular weight of 2-Amino-3,5-dibromobenzene-1-carbohydrazide is 308.96 g/mol.
The IUPAC name of the compound is 2-amino-3,5-dibromobenzohydrazide.
The InChI of 2-Amino-3,5-dibromobenzene-1-carbohydrazide is InChI=1S/C7H7Br2N3O/c8-3-1-4(7(13)12-11)6(10)5(9)2-3/h1-2H,10-11H2,(H,12,13).
The InChIKey of 2-Amino-3,5-dibromobenzene-1-carbohydrazide is GOONVUGWFUNIJB-UHFFFAOYSA-N.
There are 3 hydrogen bond donor counts in the compound.
The XLogP3-AA value of the compound is 1.7.
There is 1 rotatable bond count in the compound.
The topological polar surface area of the compound is 81.1 2.
Yes, the compound is canonicalized.