What is the molecular formula of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The molecular formula is C14H11NS.
What is the molecular weight of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The molecular weight is 225.31 g/mol.
When was Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci) first created?
It was first created on March 30, 2010.
What is the IUPAC name of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The IUPAC name is 4-methyl-3-thia-5-azatetracyclo[6.6.1.0 2,6 .0 11,15 ]pentadeca-1(14),2(6),4,7,11(15),12-hexaene.
What is the InChI of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The InChI is InChI=1S/C14H11NS/c1-8-15-12-7-10-6-5-9-3-2-4-11(13(9)10)14(12)16-8/h2-4,7H,5-6H2,1H3.
What is the Canonical SMILES of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The Canonical SMILES is CC1=NC2=C(S1)C3=CC=CC4=C3C(=C2)CC4.
How many hydrogen bond acceptor counts are there in Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
There are 2 hydrogen bond acceptor counts.
What is the exact mass of Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
The exact mass is 225.06122053 g/mol.
Is Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci) considered a canonicalized compound?
Yes, it is considered canonicalized.
How many covalently-bonded unit counts are there in Acenaphtho[4,5-d]thiazole, 4,5-dihydro-8-methyl-(7ci)?
There is 1 covalently-bonded unit count.