What is the molecular formula of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The molecular formula is C10H9Cl3N2O2.
What is the molecular weight of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The molecular weight is 295.5 g/mol.
What is the IUPAC name of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The IUPAC name is ethyl (2E)-2-chloro-2-[(3,5-dichlorophenyl)hydrazinylidene]acetate.
What is the InChI of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The InChI is InChI=1S/C10H9Cl3N2O2/c1-2-17-10(16)9(13)15-14-8-4-6(11)3-7(12)5-8/h3-5,14H,2H2,1H3/b15-9+.
What is the Canonical SMILES of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The Canonical SMILES is CCOC(=O)C(=NNC1=CC(=CC(=C1)Cl)Cl)Cl.
How many hydrogen bond donor counts are there in Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
There is 1 hydrogen bond donor count.
What is the XLogP3 value of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The XLogP3 value is 4.7.
How many hydrogen bond acceptor counts are there in Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
There are 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate?
The topological polar surface area is 50.7 Å2.
Is Ethyl 2-chloro-2-[2-(3,5-dichlorophenyl)hydrazono]acetate a covalently-bonded unit?
Yes, it is a covalently-bonded unit.