CAS
96-66-2 Purity
---
96-66-2 Purity
---
Inquiry Basket
Furo[2,3-b]quinoline,4-ethoxy-2,3-dihydro-(7ci)
CAS
96679-40-2
Catalog Number
ACM96679402
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-ethoxy-2,3-dihydrofuro[2,3-b]quinoline.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H13NO2/c1-2-15-12-9-5-3-4-6-11(9)14-13-10(12)7-8-16-13/h3-6H,2,7-8H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is KMHJCOOVAHTWHG-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CCOC1=C2CCOC2=NC3=CC=CC=C31.
What is the molecular weight of the compound?
The molecular weight of the compound is 215.25 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.9.
How many hydrogen bond donor atoms are present in the compound?
There are 0 hydrogen bond donor atoms in the compound.
How many hydrogen bond acceptor atoms are present in the compound?
There are 3 hydrogen bond acceptor atoms in the compound.
How many rotatable bonds are present in the compound?
There are 2 rotatable bonds in the compound.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 31.4 Å^2.
Recommended Products
![9-(Dimethylamino)benzo[a]phenoxazin-7-ium chloride](https://resource.alfa-chemistry.com/structure/966-62-1.gif)
CAS
96681-58-2 Purity
---
96681-58-2 Purity
---
