96592-03-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H11N5.
The molecular weight of the compound is 215.23 g/mol.
The IUPAC name of the compound is 3,8-dimethyl(2 14C)imidazolo[4,5-f]quinoxalin-2-amine.
The InChI of the compound is InChI=1S/C11H11N5/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15)/i11+2.
The InChIKey of the compound is DVCCCQNKIYNAKB-OZUIXNLOSA-N.
The canonical SMILES of the compound is CC1=CN=C2C=CC3=C(C2=N1)N=C(N3C)N.
The Isomeric SMILES of the compound is CC1=CN=C2C=CC3=C(C2=N1)N=[14C](N3C)N.
The CAS number of the compound is 96600-60-1.
The UNII of the compound is QAG4XIY254.