CAS
96471-81-7 Purity
96%
96471-81-7 Purity
96%
![1-[2-[4-[(1R,3S)-3-(4-Fluorophenyl)-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]ethyl]imidazolidin-2-one](https://resource.alfa-chemistry.com/structure/96478-43-2.gif)
Inquiry Basket
2-Methyl-4-hydroxytamoxifen
CAS
96474-35-0
Catalog Number
ACM96474350
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Methyl-4-hydroxytamoxifen?
The molecular formula of 2-Methyl-4-hydroxytamoxifen is C27H31NO2.
What is the molecular weight of 2-Methyl-4-hydroxytamoxifen?
The molecular weight of 2-Methyl-4-hydroxytamoxifen is 401.5 g/mol.
What is the IUPAC name of 2-Methyl-4-hydroxytamoxifen?
The IUPAC name of 2-Methyl-4-hydroxytamoxifen is 4-[(E)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]-3-methylphenol.
What is the InChIKey of 2-Methyl-4-hydroxytamoxifen?
The InChIKey of 2-Methyl-4-hydroxytamoxifen is NZWWUPVYFHRGOL-IMVLJIQESA-N.
What is the Canonical SMILES of 2-Methyl-4-hydroxytamoxifen?
The Canonical SMILES of 2-Methyl-4-hydroxytamoxifen is CCC(=C(C1=CC=C(C=C1)OCCN(C)C)C2=C(C=C(C=C2)O)C)C3=CC=CC=C3.
What is the CAS number of 2-Methyl-4-hydroxytamoxifen?
The CAS number of 2-Methyl-4-hydroxytamoxifen is 96474-35-0.
How many hydrogen bond donor counts does 2-Methyl-4-hydroxytamoxifen have?
2-Methyl-4-hydroxytamoxifen has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Methyl-4-hydroxytamoxifen?
The topological polar surface area of 2-Methyl-4-hydroxytamoxifen is 32.7 Ų.
What is the rotatable bond count of 2-Methyl-4-hydroxytamoxifen?
The rotatable bond count of 2-Methyl-4-hydroxytamoxifen is 8.
Is 2-Methyl-4-hydroxytamoxifen a covalently-bonded unit?
Yes, 2-Methyl-4-hydroxytamoxifen is a covalently-bonded unit.
Recommended Products
![Spiro[1,3-diazolidine-5,5'-2H,3H,4H-benzo[f]oxepane]-2,4-dione](https://resource.alfa-chemistry.com/structure/96472-14-9.gif)
CAS
96472-14-9 Purity
---
96472-14-9 Purity
---
![Cyclopent[b]indole,7-ethoxy-1,2,3,4-tetrahydro-(7ci)](https://resource.alfa-chemistry.com/structure/96472-51-4.gif)
