What is the molecular formula of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The molecular formula is C11H16O7.
When was 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose created in PubChem?
It was created on May 30, 2009.
What is the IUPAC Name of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The IUPAC Name is [(2R,3S,5S)-3,5-diacetyloxyoxolan-2-yl]methyl acetate.
What is the Canonical SMILES of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The Canonical SMILES is CC(=O)OCC1C(CC(O1)OC(=O)C)OC(=O)C.
How many Hydrogen Bond Acceptor Count does 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose have?
It has 7 Hydrogen Bond Acceptor Count.
What is the Exact Mass of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The Exact Mass is 260.08960285 g/mol.
Is 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose a Covalently-Bonded Unit?
Yes, it is a Covalently-Bonded Unit.
How many Rotatable Bond Count does 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose have?
It has 7 Rotatable Bond Count.
What is the InChIKey of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The InChIKey is QAGMBTAACMQRSS-HBNTYKKESA-N.
What is the Topological Polar Surface Area of 1,3,5-Tri-O-acetyl-2-Deoxy-beta-D-erythro-pentofuranose?
The Topological Polar Surface Area is 88.1 Ų.