96274-83-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14N2.
The molecular weight of the compound is 174.24 g/mol.
The IUPAC name of the compound is 1-(1H-indol-2-yl)-N-methylethanamine.
The InChI representation of the compound is InChI=1S/C11H14N2/c1-8(12-2)11-7-9-5-3-4-6-10(9)13-11/h3-8,12-13H,1-2H3.
The InChIKey of the compound is KLFJXADECANLNB-UHFFFAOYSA-N.
The Canonical SMILES representation of the compound is CC(C1=CC2=CC=CC=C2N1)NC.
The compound has 2 hydrogen bond donor counts.
The XLogP3 value of the compound is 1.9.
The exact mass of the compound is 174.115698455 g/mol.
Yes, the compound is canonicalized.