CAS
96149-00-7 Purity
---
96149-00-7 Purity
---
Inquiry Basket
Alpha-bromo-1-naphthaleneacetic acid ethyl ester
CAS
96155-82-7
Catalog Number
ACM96155827
Category
Other Products
Molecular Weight
293.16
Molecular Formula
C14H13BrO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
ALPHA-BROMO-1-NAPHTHALENEACETIC ACID ETHYL ESTER;Napthaleneacetic acid,alpha-bromo-ethyl ester
What is the molecular formula of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The molecular formula of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is C14H13BrO2.
What is the synonym for Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
A synonym for Alpha-bromo-1-naphthaleneacetic acid ethyl ester is ethyl 2-bromo-2-(naphthalen-1-yl)acetate.
What is the IUPAC name of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The IUPAC name of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is ethyl 2-bromo-2-naphthalen-1-ylacetate.
What is the InChIKey of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The InChIKey of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is KDAKWXQNGGIRDK-UHFFFAOYSA-N.
What is the Canonical SMILES of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The Canonical SMILES of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is CCOC(=O)C(C1=CC=CC2=CC=CC=C21)Br.
What is the molecular weight of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The molecular weight of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is 293.15 g/mol.
How many hydrogen bond donor counts does Alpha-bromo-1-naphthaleneacetic acid ethyl ester have?
Alpha-bromo-1-naphthaleneacetic acid ethyl ester has 0 hydrogen bond donor counts.
What is the topological polar surface area of Alpha-bromo-1-naphthaleneacetic acid ethyl ester?
The topological polar surface area of Alpha-bromo-1-naphthaleneacetic acid ethyl ester is 26.3 Ų.
Is Alpha-bromo-1-naphthaleneacetic acid ethyl ester a canonicalized compound?
Yes, Alpha-bromo-1-naphthaleneacetic acid ethyl ester is a canonicalized compound.
How many rotatable bond counts does Alpha-bromo-1-naphthaleneacetic acid ethyl ester have?
Alpha-bromo-1-naphthaleneacetic acid ethyl ester has 4 rotatable bond counts.
Recommended Products
![1,2-CYCLOPROPANEDICARBOXYLIC ACID BIS [(1R, 2S, 5R)]-5-METHYL-2-(1-METHYLETHYL)](https://resource.alfa-chemistry.com/structure/96149-00-7.gif)
