96185-17-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C16H14N2O.
The molecular weight of the compound is 250.29 g/mol.
The IUPAC name of the compound is 4-(5-phenyl-3,4-dihydropyrazol-2-yl)benzaldehyde.
The structure is represented as C1CN(N=C1C2=CC=CC=C2)C3=CC=C(C=C3)C=O.
The Canonical SMILES for the compound is C1CN(N=C1C2=CC=CC=C2)C3=CC=C(C=C3)C=O.
The InChIKey of the compound is BKAAHCDXVXYPHA-UHFFFAOYSA-N.
The compound has 3 hydrogen bond acceptors.
The compound has 3 rotatable bond counts.
The topological polar surface area of the compound is 32.7 Ų.
Yes, the compound is canonicalized according to PubChem.