What is the molecular formula of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
Molecular Formula: C13H21ClN2O2
When was tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate created in PubChem?
Created: 2008-03-03
What is the molecular weight of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
Molecular Weight: 272.77 g/mol
What is the IUPAC Name of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
IUPAC Name: tert-butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate
What is the Canonical SMILES of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
Canonical SMILES: CC(C)(C)OC(=O)N1CCCCC1(CCCl)C#N
How many hydrogen bond acceptor counts does tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate have?
Hydrogen Bond Acceptor Count: 3
What is the Topological Polar Surface Area of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
Topological Polar Surface Area: 53.3 Ų
Does tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate have a defined atom stereocenter count?
Defined Atom Stereocenter Count: 0
What is the XLogP3-AA value of tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate?
XLogP3-AA: 2.5
Is tert-Butyl 2-(2-chloroethyl)-2-cyanopiperidine-1-carboxylate the canonicalized compound?
Compound Is Canonicalized: Yes