What is the molecular formula of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The molecular formula is C11H6F2N2O.
What is the molecular weight of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The molecular weight is 220.17 g/mol.
What is the IUPAC name of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The IUPAC name is 2-(2,5-difluorophenyl)pyrimidine-5-carbaldehyde.
What is the InChI of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The InChI is InChI=1S/C11H6F2N2O/c12-8-1-2-10(13)9(3-8)11-14-4-7(6-16)5-15-11/h1-6H.
What is the InChIKey of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The InChIKey is BLIWAPLCNXQNSO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The canonical SMILES is C1=CC(=C(C=C1F)C2=NC=C(C=N2)C=O)F.
What is the CAS number of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The CAS number is 960198-49-6.
What is the XLogP3-AA value of 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
The XLogP3-AA value is 1.5.
How many hydrogen bond acceptors are there in 2-(2,5-Difluorophenyl)pyrimidine-5-carbaldehyde?
There are 5 hydrogen bond acceptors.
Is the compound canonicalized according to PubChem?
Yes, the compound is canonicalized according to PubChem.