CAS
960129-66-2 Purity
---
960129-66-2 Purity
---
![(S)-4-[[(tert-Butoxy)carbonyl]amino]-5-[[(tert-butyl)dimethylsilyl]oxy]pentanoic acid methyl ester](https://resource.alfa-chemistry.com/structure/96014-55-0.gif)
Inquiry Basket
(S)-N,N,1-Trimethyl-2-pyrrolidinemethanamine
CAS
96014-13-0
Catalog Number
ACM96014130
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound with PubChem CID 55262338?
The molecular formula is C8H18N2.
What is the IUPAC name of the compound?
The IUPAC name is N,N-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]methanamine.
What is the InChI of the compound?
The InChI is InChI=1S/C8H18N2/c1-9(2)7-8-5-4-6-10(8)3/h8H,4-7H2,1-3H3/t8-/m0/s1.
What is the InChIKey of the compound?
The InChIKey is YSPLERUVORSMID-QMMMGPOBSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CN1CCCC1CN(C)C.
What is the isomeric SMILES of the compound?
The isomeric SMILES is CN1CCC[C@H]1CN(C)C.
What is the molecular weight of the compound?
The molecular weight is 142.24 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
Recommended Products
