CAS
96047-32-4 Purity
---
96047-32-4 Purity
---
amino]-,3-ethyl ester](https://resource.alfa-chemistry.com/structure/960521-63-5.gif)
amino]-,ethyl ester](https://resource.alfa-chemistry.com/structure/960521-65-7.gif)
![3-Furancarboxylic acid,5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-2-[[(trans-4-methylcyclohexyl)carbonyl](1-methylethyl)amino]-,ethyl ester](https://resource.alfa-chemistry.com/structure/960521-67-9.gif)
Inquiry Basket
1-Naphthoic acid,2-ethyl-1,2,3,4-tetrahydro-4-hydroxy-5-methoxy-,methyl ester
CAS
960-50-9
Catalog Number
ACM960509
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C15H20O4.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 2-ethyl-4-hydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H20O4/c1-4-9-8-11(16)14-10(13(9)15(17)19-3)6-5-7-12(14)18-2/h5-7,9,11,13,16H,4,8H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FIUYHPMYPVTZRO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCC1CC(C2=C(C1C(=O)OC)C=CC=C2OC)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 264.32 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.3.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
Recommended Products
