CAS
95924-98-4 Purity
---
95924-98-4 Purity
---
Inquiry Basket
Cyclohexane,1,3-dimethyl-5-[(trimethylsilyl)oxy]-
CAS
959258-39-0
Catalog Number
ACM959258390
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is (3,5-dimethylcyclohexyl)oxy-trimethylsilane.
What is the molecular formula of the compound?
The molecular formula of the compound is C11H24OSi.
What is the molecular weight of the compound?
The molecular weight of the compound is 200.39 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H24OSi/c1-9-6-10(2)8-11(7-9)12-13(3,4)5/h9-11H,6-8H2,1-5H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RNBPOOCUZHNIIM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1CC(CC(C1)O[Si](C)(C)C)C.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 1 hydrogen bond acceptor count.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Benzene,1-[(ethenyldimethylsilyl)oxy]-3-methyl-](https://resource.alfa-chemistry.com/structure/959251-36-6.gif)
CAS
95926-75-3 Purity
---
95926-75-3 Purity
---
