959237-21-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H17NO2.
The synonyms of the compound include 3-(2,3-DIMETHOXYPHENYL)PYRROLIDINE, 959237-32-2, DTXSID20672384, MFCD09864261, AKOS011344361, and more.
The molecular weight of the compound is 207.27 g/mol.
The IUPAC name of the compound is 3-(2,3-dimethoxyphenyl)pyrrolidine.
The InChI of the compound is InChI=1S/C12H17NO2/c1-14-11-5-3-4-10(12(11)15-2)9-6-7-13-8-9/h3-5,9,13H,6-8H2,1-2H3.
The InChIKey of the compound is HEPGYNRBQZZNML-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=CC=CC(=C1OC)C2CCNC2.
The CAS number of the compound is 959237-32-2.
The XLogP3-AA value of the compound is 1.6.
Yes, the compound is canonicalized.