959236-59-0 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14O3.
The molecular weight of the compound is 194.23 g/mol.
The IUPAC name of the compound is 3-(hydroxymethyl)-4-propan-2-yloxybenzaldehyde.
The Canonical SMILES of the compound is CC(C)OC1=C(C=C(C=C1)C=O)CO.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 46.5 Ų.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.
The compound was last modified on 2023-12-30.