CAS
95891-30-8 Purity
96%
95891-30-8 Purity
96%
![4(3H)-Quinazolinone,2-[4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-6-methoxy-3-methyl-](https://resource.alfa-chemistry.com/structure/95893-19-9.gif)
Inquiry Basket
N-(2-Ethoxy-ethyl)-benzene-1,2-diamine
CAS
95893-89-3
Catalog Number
ACM95893893
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The molecular formula is C10H16N2O.
How much is the molecular weight of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The molecular weight is 180.25 g/mol.
What is the IUPAC name of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The IUPAC name is 2-N-(2-ethoxyethyl)benzene-1,2-diamine.
What is the InChI of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The InChI is InChI=1S/C10H16N2O/c1-2-13-8-7-12-10-6-4-3-5-9(10)11/h3-6,12H,2,7-8,11H2,1H3.
What is the Canonical SMILES of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The Canonical SMILES is CCOCCNC1=CC=CC=C1N.
How many hydrogen bond donor counts does N-(2-Ethoxy-ethyl)-benzene-1,2-diamine have?
It has 2 hydrogen bond donor counts.
What is the exact mass of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The exact mass is 180.126263138 g/mol.
How many rotatable bond counts does N-(2-Ethoxy-ethyl)-benzene-1,2-diamine have?
It has 5 rotatable bond counts.
What is the topological polar surface area of N-(2-Ethoxy-ethyl)-benzene-1,2-diamine?
The topological polar surface area is 47.3 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
95893-96-2 Purity
---
95893-96-2 Purity
---
