CAS
958454-08-5 Purity
---
958454-08-5 Purity
---
Inquiry Basket
3-Fluoro-2-(methylthiomethoxy)phenylboronic acid
CAS
958454-11-0
Catalog Number
ACM958454110
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
3-Fluoro-2-(methylthiomethoxy)phenylboronic acid
What is the molecular formula of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The molecular formula of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is C8H10BFO3S.
What is the molecular weight of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The molecular weight of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is 216.04 g/mol.
What is the IUPAC name of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The IUPAC name of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is [3-fluoro-2-(methylsulfanylmethoxy)phenyl]boronic acid.
What is the InChI of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The InChI of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is InChI=1S/C8H10BFO3S/c1-14-5-13-8-6(9(11)12)3-2-4-7(8)10/h2-4,11-12H,5H2,1H3.
What is the InChIKey of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The InChIKey of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is JODGQMNUDNXWOR-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The Canonical SMILES of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is B(C1=C(C(=CC=C1)F)OCSC)(O)O.
What is the CAS number of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The CAS number of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is 958454-11-0.
What is the hydrogen bond donor count of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The hydrogen bond donor count of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is 2.
What is the hydrogen bond acceptor count of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid?
The hydrogen bond acceptor count of 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is 5.
Is 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid a canonicalized compound?
Yes, 3-Fluoro-2-(methylthiomethoxy)phenylboronic acid is a canonicalized compound.
Recommended Products
