5-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene

CAS

958451-93-9

Catalog Number

ACM958451939

Category

Other Products

Molecular Formula

C₁₄H₁₆BFO₂S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of the compound referenced?

The molecular formula is C14H16BFO2S.

What are the synonyms for the compound?

The synonyms are: 958451-93-9, 2-(5-fluorobenzo[b]thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene, 5-Fluorobenzo[B]thiophene-2-boronic acid pinacol ester, 2-(5-FLUORO-1-BENZOTHIOPHEN-2-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE.

What is the molecular weight of the compound?

The molecular weight is 278.2 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-(5-fluoro-1-benzothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H16BFO2S/c1-13(2)14(3,4)18-15(17-13)12-8-9-7-10(16)5-6-11(9)19-12/h5-8H,1-4H3.

What is the InChIKey of the compound?

The InChIKey of the compound is XNRVFDSPXAGGNH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(S2)C=CC(=C3)F.

How many hydrogen bond donor atoms are in the compound?

There are 0 hydrogen bond donor atoms in the compound.