CAS
958451-86-0 Purity
---
958451-86-0 Purity
---
Inquiry Basket
1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride
CAS
958451-89-3
Catalog Number
ACM958451893
Category
Other Products
Molecular Weight
225.80234
Molecular Formula
C8H16ClNS2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride
What is the molecular formula of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The molecular formula of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is C8H16ClNS2.
What is the molecular weight of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The molecular weight of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is 225.8 g/mol.
What is the IUPAC name of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The IUPAC name of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is 1,5-dithia-9-azaspiro[5.5]undecane;hydrochloride.
What is the InChI of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The InChI of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is InChI=1S/C8H15NS2.ClH/c1-6-10-8(11-7-1)2-4-9-5-3-8;/h9H,1-7H2;1H.
What is the InChIKey of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The InChIKey of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is DZFBWPUVASRKLS-UHFFFAOYSA-N.
What is the canonical SMILES of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The canonical SMILES of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is C1CSC2(CCNCC2)SC1.Cl.
What is the hydrogen bond donor count of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The hydrogen bond donor count of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is 2.
What is the hydrogen bond acceptor count of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The hydrogen bond acceptor count of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is 3.
What is the topological polar surface area of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride?
The topological polar surface area of 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is 62.6Ų.
Is 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride canonicalized?
Yes, 1,5-Dithia-9-aza-spiro[5.5]undecane hydrochloride is canonicalized.
Recommended Products
![1-Oxa-4-thia-7-aza-spiro[4.5]decane hydrochloride](https://resource.alfa-chemistry.com/structure/958451-86-0.gif)
![1-Oxa-5-thia-8-aza-spiro[5.5]undecane hydrochloride](https://resource.alfa-chemistry.com/structure/958451-87-1.gif)
![6-Oxa-10-thia-2-aza-spiro[4.5]decane hydrochloride](https://resource.alfa-chemistry.com/structure/958451-88-2.gif)
![1-Oxa-4-thia-8-aza-spiro[4.5]decane,hydrochloride](https://resource.alfa-chemistry.com/structure/958451-90-6.gif)
![5-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene](https://resource.alfa-chemistry.com/structure/958451-93-9.gif)
CAS
958451-93-9 Purity
---
958451-93-9 Purity
---
