958451-80-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is C8H16ClNS2.
The molecular weight of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is 225.8 g/mol.
1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride was created on April 27, 2010.
The IUPAC name of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is 1,5-dithia-8-azaspiro[5.5]undecane;hydrochloride.
The InChI of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is InChI=1S/C8H15NS2.ClH/c1-3-8(7-9-4-1)10-5-2-6-11-8;/h9H,1-7H2;1H.
The canonical SMILES of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is C1CC2(CNC1)SCCCS2.Cl.
The hydrogen bond donor count of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is 2.
The hydrogen bond acceptor count of 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is 3.
1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride does not have any rotatable bonds.
Yes, 1,5-Dithia-8-aza-spiro[5.5]undecane hydrochloride is a canonicalized compound.