CAS
958443-30-6 Purity
---
958443-30-6 Purity
---
Inquiry Basket
3-Difluoromethoxy-4-fluoro-benzeneboronic acid
CAS
958451-70-2
Catalog Number
ACM958451702
Category
Other Products
Molecular Weight
205.9269496
Molecular Formula
C7H6BF3O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
3-difluoromethoxy-4-fluoro-benzeneboronic acid
What is the molecular formula of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The molecular formula of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is C7H6BF3O3.
What is the molecular weight of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The molecular weight of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is 205.93 g/mol.
When was 3-Difluoromethoxy-4-fluoro-benzeneboronic acid created?
3-Difluoromethoxy-4-fluoro-benzeneboronic acid was created on April 27, 2010.
What is the IUPAC name of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The IUPAC name of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is [3-(difluoromethoxy)-4-fluorophenyl]boronic acid.
What is the InChI of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The InChI of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is InChI=1S/C7H6BF3O3/c9-5-2-1-4(8(12)13)3-6(5)14-7(10)11/h1-3,7,12-13H.
What is the InChIKey of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The InChIKey of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is IQCNHLWEOWQMOW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid?
The canonical SMILES of 3-Difluoromethoxy-4-fluoro-benzeneboronic acid is B(C1=CC(=C(C=C1)F)OC(F)F)(O)O.
How many hydrogen bond donor counts does 3-Difluoromethoxy-4-fluoro-benzeneboronic acid have?
3-Difluoromethoxy-4-fluoro-benzeneboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Difluoromethoxy-4-fluoro-benzeneboronic acid have?
3-Difluoromethoxy-4-fluoro-benzeneboronic acid has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Difluoromethoxy-4-fluoro-benzeneboronic acid have?
3-Difluoromethoxy-4-fluoro-benzeneboronic acid has 3 rotatable bond counts.
Recommended Products
