What is the molecular formula of N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The molecular formula is C13H19NO.
What is the molecular weight of N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The molecular weight is 205.30 g/mol.
When was N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine created in PubChem?
It was created on May 29, 2009.
What is the IUPAC name of N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The IUPAC name is N-methyl-1-(4-phenyloxan-4-yl)methanamine.
What is the Canonical SMILES of N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The Canonical SMILES is CNCC1(CCOCC1)C2=CC=CC=C2.
What is the XLogP3-AA value for N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The XLogP3-AA value is 1.9.
How many Hydrogen Bond Donor Count does N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine have?
It has 1 Hydrogen Bond Donor Count.
What is the Topological Polar Surface Area of N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
The Topological Polar Surface Area is 21.3 Ų.
How many Rotatable Bond Count does N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine have?
It has 3 Rotatable Bond Count.
Is the Compound Is Canonicalized for N-Methyl-(4-phenyltetrahydropyran-4-yl)methylamine?
Yes, the Compound Is Canonicalized.