CAS
95823-34-0 Purity
---
95823-34-0 Purity
---
Inquiry Basket
3,4-Dimethoxyphenyl 2-(2-iodophenyl)acetate
CAS
958236-05-0
Catalog Number
ACM958236050
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C16H15IO4.
What is the molecular weight of the compound?
The molecular weight of the compound is 398.19 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (3,4-dimethoxyphenyl) 2-(2-iodophenyl)acetate.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation of the compound is COC1=C(C=C(C=C1)OC(=O)CC2=CC=CC=C2I)OC.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.9.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 44.8 Ų.
How many rotatable bond counts does the compound have?
The compound has 6 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
958235-85-3 Purity
96%
958235-85-3 Purity
96%
CAS
958243-69-1 Purity
96%
958243-69-1 Purity
96%
