What is the molecular formula of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The molecular formula is C10H12N4O4.
What is the molecular weight of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The molecular weight is 252.23 g/mol.
What is the IUPAC name of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The IUPAC name is N-[(Z)-butan-2-ylideneamino]-2,4-dinitroaniline.
What is the InChI of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The InChI is InChI=1S/C10H12N4O4/c1-3-7(2)11-12-9-5-4-8(13(15)16)6-10(9)14(17)18/h4-6,12H,3H2,1-2H3/b11-7-.
What is the InChIKey of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The InChIKey is WPWSANGSIWAACK-XFFZJAGNSA-N.
What is the canonical SMILES of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The canonical SMILES is CCC(=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C.
What is the isomeric SMILES of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The isomeric SMILES is CC/C(=N\NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])/C.
What is the CAS number of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The CAS number is 958-60-1.
What is the European Community (EC) number of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The EC number is 621-856-7.
What is the XLogP3 value of 2-Butanone, 2-(2,4-dinitrophenyl)hydrazone?
The XLogP3 value is 3.5.