957828-58-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 6-chlorochrysene.
The molecular formula of the compound is C18H11Cl.
The molecular weight of the compound is 262.7 g/mol.
The InChI of the compound is InChI=1S/C18H11Cl/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H.
The InChIKey of the compound is LVKLJLYFIFXBKM-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C2C(=C1)C=CC3=C2C=C(C4=CC=CC=C34)Cl.
The CAS number of the compound is 95791-46-1.
The XLogP3 value of the compound is 6.3.
The compound has 0 hydrogen bond donor counts.
The topological polar surface area of the compound is 0-2.