CAS
957062-77-0 Purity
98%
957062-77-0 Purity
98%
Inquiry Basket
2-(3-Bromo-phenyl)-5-ethyl-[1,3,4]oxadiazole
CAS
957065-88-1
Catalog Number
ACM957065881
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C10H9BrN2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 253.09 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(3-bromophenyl)-5-ethyl-1,3,4-oxadiazole.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CCC1=NN=C(O1)C2=CC(=CC=C2)Br.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
What is the exact mass of the compound?
The exact mass of the compound is 251.98983 g/mol.
How many topological polar surface areas does the compound have?
The compound has a topological polar surface area of 38.9 Ų.
What is the heavy atom count of the compound?
The compound has a heavy atom count of 14.
Does the compound have any defined atom stereocenter count?
The compound has 0 defined atom stereocenter counts.
Is the compound Canonicalized?
Yes, the compound is Canonicalized according to PubChem.
Recommended Products
![8-Bromo-6-methyl[1,2,4]triazolo[1,5-a]pyridine](https://resource.alfa-chemistry.com/structure/957062-94-1.gif)
![2-(3-Bromo-phenyl)-5-ethyl-[1,3,4]oxadiazole](https://resource.alfa-chemistry.com/structure/957065-88-2.gif)
