CAS
1208101-73-8 Purity
---
1208101-73-8 Purity
---
Inquiry Basket
3-Chloro-2-(4-morpholino)pyridine-4-boronicacid
CAS
957061-04-0
Catalog Number
ACM957061040-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The molecular formula of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is C9H12BClN2O3.
What is the molecular weight of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The molecular weight of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is 242.47 g/mol.
What is the IUPAC name of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The IUPAC name of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is (3-chloro-2-morpholin-4-ylpyridin-4-yl)boronic acid.
What is the InChI of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The InChI of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is InChI=1S/C9H12BClN2O3/c11-8-7(10(14)15)1-2-12-9(8)13-3-5-16-6-4-13/h1-2,14-15H,3-6H2.
What is the InChIKey of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The InChIKey of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is NCQGXSBDQBKPEJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The canonical SMILES of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is B(C1=C(C(=NC=C1)N2CCOCC2)Cl)(O)O.
How many hydrogen bond donor counts does 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid have?
3-Chloro-2-(4-morpholino)pyridine-4-boronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid have?
3-Chloro-2-(4-morpholino)pyridine-4-boronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid have?
3-Chloro-2-(4-morpholino)pyridine-4-boronic acid has 2 rotatable bond counts.
What is the topological polar surface area of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid?
The topological polar surface area of 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid is 65.8Ų.
Recommended Products
CAS
1356087-58-5 Purity
---
1356087-58-5 Purity
---
