955315-21-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H23NO.
The molecular weight of the compound is 233.35 g/mol.
The IUPAC name of the compound is 2-[(4-methoxy-3,5-dimethylphenyl)methyl]piperidine.
The InChIKey of the compound is BXCSCSJHYFFWMR-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1=CC(=CC(=C1OC)C)CC2CCCCN2.
The CAS number of the compound is 955315-30-7.
The XLogP3-AA value of the compound is 3.4.
There is 1 hydrogen bond donor count in the compound.
The topological polar surface area of the compound is 21.3 Ų.
Yes, the compound is canonicalized.