95529-19-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C16H23NO4.
The molecular weight of the compound is 293.36 g/mol.
The IUPAC name of the compound is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid.
The InChI of the compound is InChI=1S/C16H23NO4/c1-16(2,3)21-15(20)17-13(11-14(18)19)10-9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,17,20)(H,18,19).
The InChIKey of the compound is MYWZFJXOLAXENE-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(C)(C)OC(=O)NC(CCC1=CC=CC=C1)CC(=O)O.
The XLogP3-AA value of the compound is 2.8.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 8 rotatable bond counts.