What is the molecular formula of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The molecular formula is C11H21N3O.
What is the synonym for trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The synonym is 954251-72-0 TRANS-2-(4-ACETYLPIPERAZIN-1-YL)CYCLOPENTANAMINE.
What is the molecular weight of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The molecular weight is 211.30 g/mol.
What is the IUPAC name of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The IUPAC name is 1-[4-[(1R,2R)-2-aminocyclopentyl]piperazin-1-yl]ethanone.
What is the InChI code of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The InChI code is InChI=1S/C11H21N3O/c1-9(15)13-5-7-14(8-6-13)11-4-2-3-10(11)12/h10-11H,2-8,12H2,1H3/t10-,11-/m1/s1.
What are the canonical SMILES of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The canonical SMILES is CC(=O)N1CCN(CC1)C2CCCC2N.
How many hydrogen bond donor counts does trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine have?
It has one hydrogen bond donor count.
How many hydrogen bond acceptor counts does trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine have?
It has three hydrogen bond acceptor counts.
What is the topological polar surface area of trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine?
The topological polar surface area is 49.6 ?2.
Is trans-2-(4-Acetylpiperazin-1-yl)cyclopentanamine a canonicalized compound?
Yes, it is a canonicalized compound.