95413-05-1 Purity
97+%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14N2O6S2.
The IUPAC name of the compound is (5R,6S)-3-(2-carbamoyloxyethylsulfanyl)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
The molecular weight of the compound is 334.4 g/mol.
The InChI of the compound is InChI=1S/C11H14N2O6S2/c1-4(14)5-7(15)13-6(9(16)17)10(21-8(5)13)20-3-2-19-11(12)18/h4-5,8,14H,2-3H2,1H3,(H2,12,18)(H,16,17)/t4-,5+,8-/m1/s1.
The InChIKey of the compound is LVCPLOQIOKEULU-GLDDHUGJSA-N.
The canonical SMILES of the compound is CC(C1C2N(C1=O)C(=C(S2)SCCOC(=O)N)C(=O)O)O.
The isomeric SMILES of the compound is C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)SCCOC(=O)N)C(=O)O)O.
The compound has 3 hydrogen bond donor counts.
The compound has 8 hydrogen bond acceptor counts.
The compound has 7 rotatable bond counts.