953895-57-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,7-Dimethoxyquinoline-3-carbaldehyde is C12H11NO3.
The molecular weight of 2,7-Dimethoxyquinoline-3-carbaldehyde is 217.22 g/mol.
The IUPAC name of 2,7-Dimethoxyquinoline-3-carbaldehyde is 2,7-dimethoxyquinoline-3-carbaldehyde.
The InChI of 2,7-Dimethoxyquinoline-3-carbaldehyde is InChI=1S/C12H11NO3/c1-15-10-4-3-8-5-9(7-14)12(16-2)13-11(8)6-10/h3-7H,1-2H3.
The InChIKey of 2,7-Dimethoxyquinoline-3-carbaldehyde is PQECIFGEZCZGSO-UHFFFAOYSA-N.
2,7-Dimethoxyquinoline-3-carbaldehyde has 0 hydrogen bond donor counts.
The topological polar surface area of 2,7-Dimethoxyquinoline-3-carbaldehyde is 48.4 Ų.
Yes, the compound is canonicalized.
The XLogP3-AA value of 2,7-Dimethoxyquinoline-3-carbaldehyde is 1.9.
2,7-Dimethoxyquinoline-3-carbaldehyde has 3 rotatable bond counts.