953753-01-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C34H55IN2.
The synonym for the compound is 4-(4-(DIDECYLAMINO)STYRYL)-N-METHYLPYRIDINIUM IODIDE.
The molecular weight of the compound is 618.7 g/mol.
The IUPAC name of the compound is N,N-didecyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide.
The InChI of the compound is InChI=1S/C34H55N2.HI/c1-4-6-8-10-12-14-16-18-28-36(29-19-17-15-13-11-9-7-5-2)34-24-22-32(23-25-34)20-21-33-26-30-35(3)31-27-33;/h20-27,30-31H,4-19,28-29H2,1-3H3;1H/q+1;/p-1.
The Canonical SMILES of the compound is CCCCCCCCCCN(CCCCCCCCCC)C1=CC=C(C=C1)C=CC2=CC=[N+](C=C2)C.[I-].
The hydrogen bond donor count of the compound is 0.
The hydrogen bond acceptor count of the compound is 2.
The rotatable bond count of the compound is 21.
Yes, the compound is canonicalized.