95337-96-5 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is C18H20O7.
The IUPAC name of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is (3,4-dimethoxyphenyl) 2,3,4-trimethoxybenzoate.
The molecular weight of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 348.3 g/mol.
The InChI of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is InChI=1S/C18H20O7/c1-20-13-8-6-11(10-15(13)22-3)25-18(19)12-7-9-14(21-2)17(24-5)16(12)23-4/h6-10H,1-5H3.
The InChIKey of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is LDCMFZIDVAWOPU-UHFFFAOYSA-N.
There are 0 hydrogen bond donor counts in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
The topological polar surface area of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 72.4 2.
There are 0 defined atom stereocenter counts in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
Yes, the compound is canonicalized in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
The covalently-bonded unit count in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 1.