952518-08-0 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C20H22FN5O.
The molecular weight of the compound is 367.4 g/mol.
The compound was created on 2012-08-08 and last modified on 2023-12-30.
The IUPAC name of the compound is 4-fluoro-2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]indazole-7-carboxamide.
The Canonical SMILES of the compound is CN1CCN(CC1)CC2=CC=C(C=C2)N3C=C4C(=CC=C(C4=N3)C(=O)N)F.
The compound has 1 hydrogen bond donor count.
The XLogP3-AA value of the compound is 1.9.
The topological polar surface area of the compound is 67.4 Ų.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.