CAS
952480-00-1 Purity
---
952480-00-1 Purity
---
Inquiry Basket
ACETAMIDE,N,N-(5-HYDROXY-2-METHYL-1,3-PHENYLENE)BIS-
CAS
952482-03-0
Catalog Number
ACM952482030
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H14N2O3.
What are the synonyms of the compound?
The synonyms of the compound are 952482-03-0, ACETAMIDE,N,N-(5-HYDROXY-2-METHYL-1,3-PHENYLENE)BIS-, N,N'-(5-Hydroxy-2-methyl-1,3-phenylene)diacetamide, and SCHEMBL3914119.
What is the molecular weight of the compound?
The molecular weight of the compound is 222.24 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(3-acetamido-5-hydroxy-2-methylphenyl)acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H14N2O3/c1-6-10(12-7(2)14)4-9(16)5-11(6)13-8(3)15/h4-5,16H,1-3H3,(H,12,14)(H,13,15).
What is the InChIKey of the compound?
The InChIKey of the compound is POLDZPWAHFPZJJ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C(C=C(C=C1NC(=O)C)O)NC(=O)C.
What is the XLogP3-AA of the compound?
The XLogP3-AA of the compound is 0.3.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
Recommended Products
CAS
952486-65-6 Purity
96%
952486-65-6 Purity
96%
