95192-58-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Chloro-4,6-dinitrobenzoic acid is C7H3ClN2O6.
The PubChem CID 2762953 was created on July 19, 2005.
The molecular weight of 2-Chloro-4,6-dinitrobenzoic acid is 246.56 g/mol.
The IUPAC name of 2-Chloro-4,6-dinitrobenzoic acid is 2-chloro-4,6-dinitrobenzoic acid.
The Canonical SMILES representation of 2-Chloro-4,6-dinitrobenzoic acid is C1=C(C=C(C(=C1[N+](=O)[O-])C(=O)O)Cl)[N+](=O)[O-].
There are 6 hydrogen bond acceptors present in 2-Chloro-4,6-dinitrobenzoic acid.
The exact mass of 2-Chloro-4,6-dinitrobenzoic acid is 245.9679635 g/mol.
There is 1 rotatable bond present in the molecular structure of 2-Chloro-4,6-dinitrobenzoic acid.
Yes, 2-Chloro-4,6-dinitrobenzoic acid is considered a canonicalized compound.
The topological polar surface area of 2-Chloro-4,6-dinitrobenzoic acid is 129 Å2.