What is the molecular formula of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The molecular formula is C10H8BrClN2O2.
When was Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate created in PubChem?
It was created on 2008-02-29.
What is the IUPAC Name of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC Name is ethyl 8-bromo-6-chloroimidazo[1,2-a]pyridine-2-carboxylate.
What is the molecular weight of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The molecular weight is 303.54 g/mol.
What is the Canonical SMILES of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The Canonical SMILES is CCOC(=O)C1=CN2C=C(C=C(C2=N1)Br)Cl.
How many hydrogen bond donor counts does Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate have?
It has 0 hydrogen bond donor count.
What is the topological polar surface area of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The topological polar surface area is 43.6 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the XLogP3-AA value of Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate?
The XLogP3-AA value is 3.6.
How many defined atom stereocenter counts does Ethyl 8-Bromo-6-Chloroimidazo[1,2-a]pyridine-2-carboxylate have?
It has 0 defined atom stereocenter count.