95167-71-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H10BClN2O2.
The synonyms of the compound are 951771-31-6, [6-(4-Chloroanilino)pyridin-3-yl]boronic acid, 6-(4-chlorophenylamino)pyridin-3-ylboronic acid, SCHEMBL4515059, and DTXSID00701202.
The molecular weight of the compound is 248.47 g/mol.
The IUPAC name of the compound is [6-(4-chloroanilino)pyridin-3-yl]boronic acid.
The InChI of the compound is InChI=1S/C11H10BClN2O2/c13-9-2-4-10(5-3-9)15-11-6-1-8(7-14-11)12(16)17/h1-7,16-17H,(H,14,15).
The InChIKey of the compound is PIGWTPPOKZMYQX-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CN=C(C=C1)NC2=CC=C(C=C2)Cl)(O)O.
The hydrogen bond donor count of the compound is 3.
The hydrogen bond acceptor count of the compound is 4.
The topological polar surface area of the compound is 65.4 ?^2.