CAS
951625-96-0 Purity
96%
951625-96-0 Purity
96%
Inquiry Basket
ethyl3-(4-bromophenyl)-1,2,4-oxadiazole-5-carboxylate
CAS
951626-15-6
Catalog Number
ACM951626156
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound with PubChem CID 46739115?
The IUPAC name of the compound is ethyl 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carboxylate.
What is the molecular formula of the compound?
The molecular formula of the compound is C11H9BrN2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 297.10 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H9BrN2O3/c1-2-16-11(15)10-13-9(14-17-10)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RAYDPSXNIRALKY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCOC(=O)C1=NC(=NO1)C2=CC=C(C=C2)Br.
What is the CAS number of the compound?
The CAS number of the compound is 861146-12-5.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
Recommended Products
![6-TERT-BUTYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-AMINE 95%](https://resource.alfa-chemistry.com/structure/951626-63-4.gif)
