What is the molecular formula of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The molecular formula is C15H13N3O.
What is the molecular weight of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The molecular weight is 251.28 g/mol.
What is the IUPAC name of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The IUPAC name is 1-benzyl-3-diazenylindol-2-ol.
What is the InChI of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The InChI is InChI=1S/C15H13N3O/c16-17-14-12-8-4-5-9-13(12)18(15(14)19)10-11-6-2-1-3-7-11/h1-9,16,19H,10H2.
What is the InChIKey of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The InChIKey is BVXUVNCJYYVIQH-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The canonical SMILES is C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=C2O)N=N.
What is the XLogP3-AA value of 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
The XLogP3-AA value is 4.2.
How many hydrogen bond donor counts are there in 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
There are 3 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 1-Benzyl-3-hydrazono-1,3-dihydro-indol-2-one?
There are 3 rotatable bond counts.