949-69-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 6,7-dimethyl-4-oxochromene-3-carbonitrile.
The molecular formula of the compound is C12H9NO2.
The molecular weight of the compound is 199.20 g/mol.
The InChI of the compound is InChI=1S/C12H9NO2/c1-7-3-10-11(4-8(7)2)15-6-9(5-13)12(10)14/h3-4,6H,1-2H3.
The InChIKey of the compound is YBBAUISOAUXLKI-UHFFFAOYSA-N.
The CAS number of the compound is 94978-86-6.
The XLogP3-AA value of the compound is 2.2.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 0 rotatable bond counts.