What is the molecular formula of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The molecular formula is C21H21N.
What is the molecular weight of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The molecular weight is 287.4 g/mol.
When was Benzeneethanamine,b-phenyl-a-(phenylmethyl)- created and modified in PubChem?
It was created on 2007-07-16 and modified on 2023-12-30.
What is the IUPAC name of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The IUPAC name is (2R)-1,1,3-triphenylpropan-2-amine.
What is the InChI code of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The InChI is InChI=1S/C21H21N/c22-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-21H,16,22H2/t20-/m1/s1.
What is the Canonical SMILES of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The Canonical SMILES is C1=CC=C(C=C1)CC(C(C2=CC=CC=C2)C3=CC=CC=C3)N.
How many hydrogen bond donor counts does Benzeneethanamine,b-phenyl-a-(phenylmethyl)- have?
It has 1 hydrogen bond donor count.
What is the exact mass of Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
The exact mass is 287.167399674 g/mol.
Does Benzeneethanamine,b-phenyl-a-(phenylmethyl)- have any defined atom stereocenter count?
It has 1 defined atom stereocenter count.
Is the compound canonicalized for Benzeneethanamine,b-phenyl-a-(phenylmethyl)-?
Yes, the compound is canonicalized.