94923-29-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C20H32O6.
The IUPAC name of the compound is ethyl (E)-4-[(3aS,4R,7R,7aR)-7-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate.
The InChIKey of the compound is OHMPDEIJLFPZCQ-USDTXFSSSA-N.
The canonical SMILES representation of the compound is CCOC(=O)C=C(C)CC1C2C(C(CO1)CCO)OC3(O2)CCCCC3.
The XLogP3-AA value of the compound is 2.8.
There are 1 hydrogen bond donor atom in the compound.
There are 6 hydrogen bond acceptor atoms in the compound.
There are 7 rotatable bonds in the compound.
The exact mass of the compound is 368.21988874 g/mol.
Yes, the compound is canonicalized.